id
int64 0
1.55k
| molecules
dict | ground_truth
stringlengths 10
167
| messages
listlengths 3
3
|
---|---|---|---|
1,506 | {
"selfies": [
"[C][C][Branch1][C][C][Branch1][C][C][O][C][=Branch1][C][=O][N][C][C][C][N][C][Ring1][Branch1]",
"[O][=C][C][C][C][Branch1][C][O][Branch1][N][C][=C][C][=C][Branch1][C][F][C][=C][Ring1][#Branch1][C][C][Ring1][=C]",
"[C][C][=Branch1][C][=O][O]",
"[C][C][Branch1][C][C][O]",
"[C][C][O][C][Branch1][C][C][=O]",
"[C][O]",
"[BH3-1][C][#N]",
"[Na+1]"
],
"smiles": [
"CC(C)(C)OC(=O)NC1CCNC1",
"O=C1CCC(O)(c2ccc(F)cc2)CC1",
"CC(=O)O",
"CC(C)O",
"CCOC(C)=O",
"CO",
"[BH3-]C#N",
"[Na+]"
]
} | CC(C)(C)OC(=O)NC1CCN(C2CCC(O)(c3ccc(F)cc3)CC2)C1 | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the product of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the product molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Based on the given reactants and reagents: <molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>, what product could potentially be produced?",
"role": "user"
},
{
"content": "CC(C)(C)OC(=O)NC1CCN(C2CCC(O)(c3ccc(F)cc3)CC2)C1",
"role": "assistant"
}
] |
1,507 | {
"selfies": [
"[N][C][=N][C][=C][C][=C][Branch2][Ring2][Branch1][O][C][=C][C][=C][C][Branch2][Ring1][Branch2][C][=Branch1][C][=O][N][C][=C][C][=C][C][Branch1][=Branch2][C][Branch1][C][F][Branch1][C][F][F][=C][Ring1][#Branch2][=C][Ring2][Ring1][Ring1][C][=C][Ring2][Ring1][#Branch2][S][Ring2][Ring1][=N]",
"[O][=C][Branch1][C][Cl][C][C][C][Ring1][Ring1]",
"[C][N][Branch1][C][C][C][=C][C][=N][C][=C][Ring1][=Branch1]",
"[O]",
"[C][=C][C][=N][C][=C][Ring1][=Branch1]"
],
"smiles": [
"Nc1nc2ccc(Oc3cccc(C(=O)Nc4cccc(C(F)(F)F)c4)c3)cc2s1",
"O=C(Cl)C1CC1",
"CN(C)c1ccncc1",
"O",
"c1ccncc1"
]
} | O=C(Nc1cccc(C(F)(F)F)c1)c1cccc(Oc2ccc3nc(NC(=O)C4CC4)sc3c2)c1 | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the product of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the product molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Predict a possible product from the listed reactants and reagents. <molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>",
"role": "user"
},
{
"content": "O=C(Nc1cccc(C(F)(F)F)c1)c1cccc(Oc2ccc3nc(NC(=O)C4CC4)sc3c2)c1",
"role": "assistant"
}
] |
1,508 | {
"selfies": [
"[C][C][C][C][C][C][C][C][C][C][O][C][=C][C][=C][C][=C][Branch1][=Branch1][C][=Branch1][C][=O][Cl][C][=C][C][Ring1][=Branch2][=C][Ring1][=N]",
"[C][C][C][C][C][=C][C][=C][Branch1][C][O][C][Branch1][C][N][=C][Ring1][Branch2]",
"[C][C][O][C][C][O][Ring1][=Branch1]",
"[O]",
"[C][=C][C][=N][C][=C][Ring1][=Branch1]"
],
"smiles": [
"CCCCCCCCCCOc1ccc2cc(C(=O)Cl)ccc2c1",
"CCCCc1ccc(O)c(N)c1",
"C1COCCO1",
"O",
"c1ccncc1"
]
} | CCCCCCCCCCOc1ccc2cc(C(=O)Nc3cc(CCCC)ccc3O)ccc2c1 | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the product of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the product molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Predict a possible product from the listed reactants and reagents. <molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>",
"role": "user"
},
{
"content": "CCCCCCCCCCOc1ccc2cc(C(=O)Nc3cc(CCCC)ccc3O)ccc2c1",
"role": "assistant"
}
] |
1,509 | {
"selfies": [
"[C][C][O][C][Branch1][=C][C][O][C][=C][N][=C][Branch1][C][Cl][N][=C][Ring1][#Branch1][O][C][C]",
"[C][N][C][=C][C][Branch2][Ring1][Ring1][N][C][=N][C][=N][C][=C][C][=C][Branch1][C][O][C][=C][Ring1][O][Ring1][#Branch1][=N][Ring1][P]",
"[C][C][=Branch1][C][=O][N][Branch1][C][C][C]",
"[C][C][Branch1][C][C][Branch1][C][C][O-1]",
"[O]",
"[K+1]"
],
"smiles": [
"CCOC(COc1cnc(Cl)nc1)OCC",
"Cn1ccc(Nc2ncnc3ccc(O)cc23)n1",
"CC(=O)N(C)C",
"CC(C)(C)[O-]",
"O",
"[K+]"
]
} | CCOC(COc1cnc(Oc2ccc3ncnc(Nc4ccn(C)n4)c3c2)nc1)OCC | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the product of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the product molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Using <molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d> as the reactants and reagents, tell me the potential product.",
"role": "user"
},
{
"content": "CCOC(COc1cnc(Oc2ccc3ncnc(Nc4ccn(C)n4)c3c2)nc1)OCC",
"role": "assistant"
}
] |
1,510 | {
"selfies": [
"[C][C][O][C][=Branch1][C][=O][C][C][C][C][N][Branch2][Ring2][#Branch2][C][C][C][=C][S][C][Branch2][Ring1][=N][N][C][=Branch1][C][=O][N][C][=C][C][=C][Branch1][C][C][C][=C][Ring1][#Branch1][C][=Branch1][C][=O][C][C][C][C][C][Ring1][Branch1][=N][Ring2][Ring1][#Branch1][C][Ring2][Ring1][#C]",
"[Li+1]",
"[OH1-1]"
],
"smiles": [
"CCOC(=O)C1CCCN(CCc2csc(NC(=O)Nc3ccc(C)cc3C(=O)C3CCCC3)n2)C1",
"[Li+]",
"[OH-]"
]
} | Cc1ccc(NC(=O)Nc2nc(CCN3CCCC(C(=O)O)C3)cs2)c(C(=O)C2CCCC2)c1 | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the product of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the product molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Based on the given reactants and reagents: <molecule_2d>.<molecule_2d>.<molecule_2d>, what product could potentially be produced?",
"role": "user"
},
{
"content": "Cc1ccc(NC(=O)Nc2nc(CCN3CCCC(C(=O)O)C3)cs2)c(C(=O)C2CCCC2)c1",
"role": "assistant"
}
] |
1,511 | {
"selfies": [
"[C][N][C][=C][Branch1][C][Br][C][=C][Branch2][Ring2][O][N][C][=C][C][=C][Branch2][Ring1][=C][N][C][C][N][Branch2][Ring1][Ring1][C][C][O][Si][Branch1][C][C][Branch1][C][C][C][Branch1][C][C][Branch1][C][C][C][C][C][Ring1][S][C][=N][Ring2][Ring1][=Branch1][C][Ring2][Ring1][=C][=O]",
"[C][C][Branch1][C][C][C][C][C][C][Ring1][=Branch1][Branch1][#Branch2][C][S][=Branch1][C][=O][=Branch1][C][=O][O][C][=Branch1][C][=O][C][Ring1][N]",
"[C][O]",
"[O]"
],
"smiles": [
"Cn1cc(Br)cc(Nc2ccc(N3CCN(CCO[Si](C)(C)C(C)(C)C)CC3)cn2)c1=O",
"CC1(C)C2CCC1(CS(=O)(=O)O)C(=O)C2",
"CO",
"O"
]
} | Cn1cc(Br)cc(Nc2ccc(N3CCN(CCO)CC3)cn2)c1=O | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the product of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the product molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Predict the product of a chemical reaction with <molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d> as the reactants and reagents.",
"role": "user"
},
{
"content": "Cn1cc(Br)cc(Nc2ccc(N3CCN(CCO)CC3)cn2)c1=O",
"role": "assistant"
}
] |
1,512 | {
"selfies": [
"[N][C][C][C][C][C][C][Ring1][=Branch1][N][C][=Branch1][C][=S][N][C][=C][C][Branch1][=Branch2][C][Branch1][C][F][Branch1][C][F][F][=C][C][Branch1][=Branch2][C][Branch1][C][F][Branch1][C][F][F][=C][Ring1][=C]",
"[O][=C][C][=C][C][=C][C][=C][Ring1][=Branch1]",
"[C][O]",
"[BH4-1]",
"[Cl-1]",
"[NH4+1]",
"[NH4+1]",
"[Na+1]",
"[OH1-1]"
],
"smiles": [
"NC1CCCCC1NC(=S)Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1",
"O=Cc1ccccc1",
"CO",
"[BH4-]",
"[Cl-]",
"[NH4+]",
"[NH4+]",
"[Na+]",
"[OH-]"
]
} | FC(F)(F)c1cc(NC(=S)NC2CCCCC2NCc2ccccc2)cc(C(F)(F)F)c1 | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the product of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the product molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Consider that for a chemical reaction, if <molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d> is/are the reactants and reagents, what can be the product?",
"role": "user"
},
{
"content": "FC(F)(F)c1cc(NC(=S)NC2CCCCC2NCc2ccccc2)cc(C(F)(F)F)c1",
"role": "assistant"
}
] |
1,513 | {
"selfies": [
"[C][C][=Branch1][C][=O][Cl]",
"[N][C][=C][C][=C][Branch1][P][C][=C][S][C][=C][C][=N][C][Branch1][C][N][=C][Ring1][#Branch2][Ring1][#Branch1][C][=C][Ring1][S]",
"[C][C][C][O][C][Ring1][Branch1]",
"[C][N][C][C][O][C][C][Ring1][=Branch1]"
],
"smiles": [
"CC(=O)Cl",
"Nc1ccc(-c2csc3ccnc(N)c23)cc1",
"C1CCOC1",
"CN1CCOCC1"
]
} | CC(=O)Nc1ccc(-c2csc3ccnc(N)c23)cc1 | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the product of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the product molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d> Based on the reactants and reagents given above, suggest a possible product.",
"role": "user"
},
{
"content": "CC(=O)Nc1ccc(-c2csc3ccnc(N)c23)cc1",
"role": "assistant"
}
] |
1,514 | {
"selfies": [
"[Br][C][C][=C][C][=C][C][=C][Ring1][=Branch1]",
"[O][C][C][C][=C][O][C][Branch1][=Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][=N][Ring1][O]",
"[C][C][C][O][C][Ring1][Branch1]",
"[C][C][C][C][N+1][Branch1][Branch1][C][C][C][C][Branch1][Branch1][C][C][C][C][C][C][C][C]",
"[H-1]",
"[I-1]",
"[Na+1]"
],
"smiles": [
"BrCc1ccccc1",
"OCCc1coc(-c2ccccc2)n1",
"C1CCOC1",
"CCCC[N+](CCCC)(CCCC)CCCC",
"[H-]",
"[I-]",
"[Na+]"
]
} | c1ccc(COCCc2coc(-c3ccccc3)n2)cc1 | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the product of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the product molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Given the following reactants and reagents, please provide a possible product. <molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>",
"role": "user"
},
{
"content": "c1ccc(COCCc2coc(-c3ccccc3)n2)cc1",
"role": "assistant"
}
] |
1,515 | {
"selfies": [
"[C][C][Branch1][C][C][Branch1][C][C][O][C][=Branch1][C][=O][N][C][C][N][C][C][Ring1][=Branch1]",
"[C][C][O][C][=Branch1][C][=O][C][N][=C][Branch1][C][Br][S][C][=Ring1][=Branch1][N][C]",
"[C][C][O][C][C][O][Ring1][=Branch1]",
"[C][C][N][Branch1][=Branch1][C][Branch1][C][C][C][C][Branch1][C][C][C]"
],
"smiles": [
"CC(C)(C)OC(=O)N1CCNCC1",
"CCOC(=O)c1nc(Br)sc1NC",
"C1COCCO1",
"CCN(C(C)C)C(C)C"
]
} | CCOC(=O)c1nc(N2CCN(C(=O)OC(C)(C)C)CC2)sc1NC | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the product of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the product molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d> Based on the reactants and reagents given above, suggest a possible product.",
"role": "user"
},
{
"content": "CCOC(=O)c1nc(N2CCN(C(=O)OC(C)(C)C)CC2)sc1NC",
"role": "assistant"
}
] |
1,516 | {
"selfies": [
"[C][C][O][C][=Branch1][C][=O][C][N][=C][Branch1][#Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][C][N][Branch1][C][C][C][=Ring1][=N][C][C][C][C][C][C][C][Branch1][O][C][C][Branch1][Ring2][C][Ring1][=Branch1][C][Ring1][=Branch2][C][Ring1][#Branch2]",
"[C][C][O]",
"[Cl]",
"[K+1]",
"[OH1-1]"
],
"smiles": [
"CCOC(=O)c1nc(-c2ccccc2C)n(C)c1CCC12CC3CC(CC(C3)C1)C2",
"CCO",
"Cl",
"[K+]",
"[OH-]"
]
} | Cc1ccccc1-c1nc(C(=O)O)c(CCC23CC4CC(CC(C4)C2)C3)n1C | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the product of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the product molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Please provide a feasible product that could be formed using these reactants and reagents: <molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d> .",
"role": "user"
},
{
"content": "Cc1ccccc1-c1nc(C(=O)O)c(CCC23CC4CC(CC(C4)C2)C3)n1C",
"role": "assistant"
}
] |
1,517 | {
"selfies": [
"[C][O][C][=C][C][=C][Branch2][Branch1][=N][C][=Branch1][C][=O][C][N][C][C][N][Branch2][Ring2][N][C][=C][C][=C][Branch1][=Branch1][C][=C][Ring1][=Branch1][F][C][=Branch1][C][=O][C][Branch1][=Branch1][C][=Branch1][C][=O][O][=C][N][Ring1][=N][C][=C][C][=C][Branch1][=Branch1][N+1][=Branch1][C][=O][O-1][C][=C][Ring1][=Branch2][F][C][C][Ring2][Ring1][#C][C][=C][Ring2][Ring2][Branch2]",
"[C][C][O]",
"[H][H]",
"[Pd]"
],
"smiles": [
"COc1ccc(C(=O)CN2CCN(c3cc4c(cc3F)c(=O)c(C(=O)O)cn4-c3ccc([N+](=O)[O-])cc3F)CC2)cc1",
"CCO",
"[H][H]",
"[Pd]"
]
} | COc1ccc(C(=O)CN2CCN(c3cc4c(cc3F)c(=O)c(C(=O)O)cn4-c3ccc(N)cc3F)CC2)cc1 | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the product of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the product molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Please provide a feasible product that could be formed using these reactants and reagents: <molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d> .",
"role": "user"
},
{
"content": "COc1ccc(C(=O)CN2CCN(c3cc4c(cc3F)c(=O)c(C(=O)O)cn4-c3ccc(N)cc3F)CC2)cc1",
"role": "assistant"
}
] |
1,518 | {
"selfies": [
"[C][O][C][=C][C][=C][Branch2][=Branch1][O][C][N][C][=Branch1][C][=O][C][Branch1][S][N][C][=Branch1][C][=O][O][C][C][=C][C][=C][C][=C][Ring1][=Branch1][C][Ring1][S][C][N][N][=C][Branch1][Ring1][C][N][C][Branch2][Ring1][S][C][O][Si][Branch1][=Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][Branch1][=Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][C][Branch1][C][C][Branch1][C][C][C][=N][Ring2][Ring1][#Branch2][C][Branch1][Ring1][O][C][=C][Ring2][Branch1][Ring2]",
"[O][=N+1][Branch1][C][O-1][C][=C][C][=C][C][=C][Ring1][=Branch1][S][=Branch1][C][=O][=Branch1][C][=O][Cl]",
"[Cl][C][Cl]"
],
"smiles": [
"COc1ccc(CN2C(=O)C(NC(=O)OCc3ccccc3)C2Cn2nc(CN)c(CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)n2)c(OC)c1",
"O=[N+]([O-])c1ccccc1S(=O)(=O)Cl",
"ClCCl"
]
} | COc1ccc(CN2C(=O)C(NC(=O)OCc3ccccc3)C2Cn2nc(CNS(=O)(=O)c3ccccc3[N+](=O)[O-])c(CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)n2)c(OC)c1 | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the product of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the product molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Propose a potential product given these reactants and reagents. <molecule_2d>.<molecule_2d>.<molecule_2d>",
"role": "user"
},
{
"content": "COc1ccc(CN2C(=O)C(NC(=O)OCc3ccccc3)C2Cn2nc(CNS(=O)(=O)c3ccccc3[N+](=O)[O-])c(CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)n2)c(OC)c1",
"role": "assistant"
}
] |
1,519 | {
"selfies": [
"[C][C][=Branch1][C][=O][Cl]",
"[O][C][C][N][C][=Branch1][C][=S][N][C][C][S][C][=C][Branch1][C][F][C][=C][C][=C][Ring1][#Branch1][Ring1][#Branch2]",
"[C][C][C][O][C][Ring1][Branch1]",
"[C][C][O][C][Branch1][C][C][=O]",
"[C][N][Branch1][C][C][C][=C][C][=N][C][=C][Ring1][=Branch1]",
"[C][=C][C][=N][C][=C][Ring1][=Branch1]"
],
"smiles": [
"CC(=O)Cl",
"OCCNC(=S)NC1CSc2c(F)cccc21",
"C1CCOC1",
"CCOC(C)=O",
"CN(C)c1ccncc1",
"c1ccncc1"
]
} | CC(=O)OCCNC(=S)NC1CSc2c(F)cccc21 | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the product of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the product molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Propose a potential product given these reactants and reagents. <molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>",
"role": "user"
},
{
"content": "CC(=O)OCCNC(=S)NC1CSc2c(F)cccc21",
"role": "assistant"
}
] |
1,520 | {
"selfies": [
"[C][O][C][=Branch1][C][=O][C][C][=C][C][=C][Branch2][Ring1][P][C][C][Branch2][Ring1][Ring2][N][S][=Branch1][C][=O][=Branch1][C][=O][C][=C][C][=C][Branch1][C][Cl][C][=C][Ring1][#Branch1][C][=C][C][=C][N][=C][Ring1][=Branch1][C][=C][Ring2][Ring1][=Branch2]",
"[Cl]",
"[Na+1]",
"[OH1-1]"
],
"smiles": [
"COC(=O)Cc1ccc(CC(NS(=O)(=O)c2ccc(Cl)cc2)c2cccnc2)cc1",
"Cl",
"[Na+]",
"[OH-]"
]
} | O=C(O)Cc1ccc(CC(NS(=O)(=O)c2ccc(Cl)cc2)c2cccnc2)cc1 | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the product of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the product molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d> Considering the given starting materials, what might be the resulting product in a chemical reaction?",
"role": "user"
},
{
"content": "O=C(O)Cc1ccc(CC(NS(=O)(=O)c2ccc(Cl)cc2)c2cccnc2)cc1",
"role": "assistant"
}
] |
1,521 | {
"selfies": [
"[C][O][C][=Branch1][C][=O][C][C][=C][Branch2][Ring1][Ring2][O][C][=Branch1][C][=O][C][=C][C][=C][Branch1][Branch1][N][C][=N][N][C][=C][Ring1][#Branch2][C][=C][C][=C][C][Branch1][=Branch1][C][=Branch1][C][=N][N][=C][C][=C][Ring2][Ring1][#Branch2][Ring1][=Branch2]",
"[C][S][=Branch1][C][=O][=Branch1][C][=O][O]"
],
"smiles": [
"COC(=O)Cc1c(OC(=O)c2ccc(NC=NN)cc2)ccc2cc(C(=N)N)ccc12",
"CS(=O)(=O)O"
]
} | N=C(N)c1ccc2c(CC(=O)O)c(OC(=O)c3ccc(NC=NN)cc3)ccc2c1 | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the product of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the product molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Can you tell me the potential product of a chemical reaction that uses <molecule_2d>.<molecule_2d> as the reactants and reagents?",
"role": "user"
},
{
"content": "N=C(N)c1ccc2c(CC(=O)O)c(OC(=O)c3ccc(NC=NN)cc3)ccc2c1",
"role": "assistant"
}
] |
1,522 | {
"selfies": [
"[C][=C][C][O][C][=Branch1][C][=O][N][C][Branch2][Ring1][C][C][C][=C][C][Branch1][Branch2][C][C][C][C][N][Ring1][Branch1][=N][O][Ring1][#Branch2][C][=Branch1][C][=O][O][C][C]",
"[O][=C][Branch1][C][Cl][C][=C][C][=C][C][=C][Ring1][=Branch1]",
"[C][C][O][C][Branch1][C][C][=O]",
"[Cl]",
"[Cl][C][Cl]",
"[C][=C][C][=N][C][=C][Ring1][=Branch1]"
],
"smiles": [
"C=CCOC(=O)NC(Cc1cc(C2CCCN2)no1)C(=O)OCC",
"O=C(Cl)c1ccccc1",
"CCOC(C)=O",
"Cl",
"ClCCl",
"c1ccncc1"
]
} | C=CCOC(=O)NC(Cc1cc(C2CCCN2C(=O)c2ccccc2)no1)C(=O)OCC | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the product of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the product molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Given the following reactants and reagents, please provide a possible product. <molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>",
"role": "user"
},
{
"content": "C=CCOC(=O)NC(Cc1cc(C2CCCN2C(=O)c2ccccc2)no1)C(=O)OCC",
"role": "assistant"
}
] |
1,523 | {
"selfies": [
"[C][O][C][=C][C][=N][C][=N][C][Branch2][Ring2][=Branch1][N][C][=C][C][Branch2][Ring1][Branch2][N][C][=Branch1][C][=O][C][=C][C][=N][C][Branch1][=Branch2][N][C][C][O][C][C][Ring1][=Branch1][=C][Ring1][N][=C][C][=C][Ring2][Ring1][Branch1][C][=C][Ring2][Ring1][=N][C][=C][Ring2][Ring1][P][O][C][Branch1][C][C][=O]",
"[Cl]",
"[Cl]",
"[N]"
],
"smiles": [
"COc1cc2ncnc(Nc3cc(NC(=O)c4ccnc(N5CCOCC5)c4)ccc3C)c2cc1OC(C)=O",
"Cl",
"Cl",
"N"
]
} | COc1cc2ncnc(Nc3cc(NC(=O)c4ccnc(N5CCOCC5)c4)ccc3C)c2cc1O | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the product of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the product molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Using <molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d> as the reactants and reagents, tell me the potential product.",
"role": "user"
},
{
"content": "COc1cc2ncnc(Nc3cc(NC(=O)c4ccnc(N5CCOCC5)c4)ccc3C)c2cc1O",
"role": "assistant"
}
] |
1,524 | {
"selfies": [
"[C][C][=Branch1][C][=O][O][C][C][=C][Branch1][C][Cl][C][=C][Branch2][Ring2][Ring1][C][=C][C][=C][Branch2][Ring1][#Branch1][C][=Branch1][C][=O][N][C][C][C][Branch1][=Branch2][C][Branch1][C][F][Branch1][C][F][F][C][C][Ring1][#Branch2][C][=C][Ring2][Ring1][C][C][=C][Ring2][Ring1][=Branch2][Cl]",
"[C][O]",
"[O][=C][Branch1][C][O-1][O-1]",
"[K+1]",
"[K+1]"
],
"smiles": [
"CC(=O)OCc1c(Cl)cc(-c2ccc(C(=O)N3CCC(C(F)(F)F)CC3)cc2)cc1Cl",
"CO",
"O=C([O-])[O-]",
"[K+]",
"[K+]"
]
} | O=C(c1ccc(-c2cc(Cl)c(CO)c(Cl)c2)cc1)N1CCC(C(F)(F)F)CC1 | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the product of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the product molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Propose a potential product given these reactants and reagents. <molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>",
"role": "user"
},
{
"content": "O=C(c1ccc(-c2cc(Cl)c(CO)c(Cl)c2)cc1)N1CCC(C(F)(F)F)CC1",
"role": "assistant"
}
] |
1,525 | {
"selfies": [
"[N][C][=N][C][=N][C][S][N][=C][Branch1][S][C][=C][C][=C][Branch1][=Branch1][N+1][=Branch1][C][=O][O-1][C][=C][Ring1][=Branch2][C][Ring2][Ring1][C][=Ring1][=C]",
"[C][C][O]",
"[O]",
"[Cl-1]",
"[Fe]",
"[NH4+1]"
],
"smiles": [
"Nc1ncnc2snc(-c3ccc([N+](=O)[O-])cc3)c12",
"CCO",
"O",
"[Cl-]",
"[Fe]",
"[NH4+]"
]
} | Nc1ccc(-c2nsc3ncnc(N)c23)cc1 | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the product of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the product molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Based on the given reactants and reagents: <molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>, what product could potentially be produced?",
"role": "user"
},
{
"content": "Nc1ccc(-c2nsc3ncnc(N)c23)cc1",
"role": "assistant"
}
] |
1,526 | {
"selfies": [
"[C][O][C][=Branch1][C][=O][C][N][C][=Branch1][C][=O][C][=C][C][=N][C][=C][Ring1][=Branch1][N][Branch2][Ring1][Branch1][C][C][=C][N][Branch1][C][C][C][=C][C][=C][C][Branch1][C][C][=C][Ring1][O][Ring1][#Branch1][C][Ring2][Ring1][#Branch1][=O]",
"[C][C][O][C][C][O][Ring1][=Branch1]",
"[Cl]",
"[O]",
"[Li+1]",
"[OH1-1]"
],
"smiles": [
"COC(=O)Cn1c(=O)c2ccncc2n(Cc2cn(C)c3cccc(C)c23)c1=O",
"C1COCCO1",
"Cl",
"O",
"[Li+]",
"[OH-]"
]
} | Cc1cccc2c1c(Cn1c(=O)n(CC(=O)O)c(=O)c3ccncc31)cn2C | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the product of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the product molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Propose a potential product given these reactants and reagents. <molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>",
"role": "user"
},
{
"content": "Cc1cccc2c1c(Cn1c(=O)n(CC(=O)O)c(=O)c3ccncc31)cn2C",
"role": "assistant"
}
] |
1,527 | {
"selfies": [
"[N][C][=C][C][=C][C][C][=Branch1][C][=O][N][Branch2][Ring1][Ring2][C][C][=C][C][=C][Branch1][=Branch2][C][Branch1][C][F][Branch1][C][F][F][N][=C][Ring1][#Branch2][C][=C][C][Ring2][Ring1][=Branch1][=Ring2][Ring1][C]",
"[O][=C][Branch1][C][O][C][C][=C][C][=C][Branch1][C][Cl][C][Branch1][=Branch2][C][Branch1][C][F][Branch1][C][F][F][=C][Ring1][O]",
"[C][C][N][Branch1][=Branch1][C][Branch1][C][C][C][C][Branch1][C][C][C]",
"[C][O]",
"[O][=S][Branch1][C][Cl][Cl]"
],
"smiles": [
"Nc1cccc2c(=O)n(Cc3ccc(C(F)(F)F)nc3)ccc12",
"O=C(O)Cc1ccc(Cl)c(C(F)(F)F)c1",
"CCN(C(C)C)C(C)C",
"CO",
"O=S(Cl)Cl"
]
} | O=C(Cc1ccc(Cl)c(C(F)(F)F)c1)Nc1cccc2c(=O)n(Cc3ccc(C(F)(F)F)nc3)ccc12 | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the product of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the product molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Predict a possible product from the listed reactants and reagents. <molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>",
"role": "user"
},
{
"content": "O=C(Cc1ccc(Cl)c(C(F)(F)F)c1)Nc1cccc2c(=O)n(Cc3ccc(C(F)(F)F)nc3)ccc12",
"role": "assistant"
}
] |
1,528 | {
"selfies": [
"[C][O][N][=C][Branch2][Ring2][=Branch1][C][O][C][=C][C][=C][Branch2][Ring1][Branch2][C][O][C][=C][C][=C][Branch1][N][C][Branch1][C][O][C][C][=Branch1][C][=O][O][C][C][=C][Ring1][=N][C][=C][Ring2][Ring1][Branch1][C][=C][C][=C][C][=C][Ring1][=Branch1]",
"[C][C][C][O][C][Ring1][Branch1]",
"[C][O]",
"[O]",
"[Na+1]",
"[OH1-1]"
],
"smiles": [
"CON=C(COc1ccc(COc2ccc(C(O)CC(=O)OC)cc2)cc1)c1ccccc1",
"C1CCOC1",
"CO",
"O",
"[Na+]",
"[OH-]"
]
} | CON=C(COc1ccc(COc2ccc(C(O)CC(=O)O)cc2)cc1)c1ccccc1 | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the product of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the product molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Can you tell me the potential product of a chemical reaction that uses <molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d> as the reactants and reagents?",
"role": "user"
},
{
"content": "CON=C(COc1ccc(COc2ccc(C(O)CC(=O)O)cc2)cc1)c1ccccc1",
"role": "assistant"
}
] |
1,529 | {
"selfies": [
"[N][C][=N][C][Branch1][Branch2][C][C][=C][O][C][=Ring1][Branch1][=C][Branch1][=N][C][=Branch1][C][=O][C][C][C][O][C][C][Ring1][=Branch1][S][Ring2][Ring1][C]",
"[O][=C][Branch1][C][O][C][C][=C][C][=C][N][=C][Ring1][=Branch1]",
"[C][C][N][Branch1][Ring1][C][C][C][C]",
"[C][C][N][=C][=N][C][C][C][N][Branch1][C][C][C]",
"[C][N][Branch1][C][C][C][=O]",
"[Cl]",
"[Cl]",
"[O]",
"[O][=C][Branch1][C][O-1][O]",
"[O][N][N][=N][C][=C][C][=C][C][=C][Ring1][=Branch1][Ring1][=Branch2]",
"[Na+1]"
],
"smiles": [
"Nc1nc(-c2ccoc2)c(C(=O)C2CCOCC2)s1",
"O=C(O)Cc1cccnc1",
"CCN(CC)CC",
"CCN=C=NCCCN(C)C",
"CN(C)C=O",
"Cl",
"Cl",
"O",
"O=C([O-])O",
"On1nnc2ccccc21",
"[Na+]"
]
} | O=C(Cc1cccnc1)Nc1nc(-c2ccoc2)c(C(=O)C2CCOCC2)s1 | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the product of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the product molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "A chemical reaction has started with the substance(s) <molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d> as the reactants and reagents, what could be a probable product?",
"role": "user"
},
{
"content": "O=C(Cc1cccnc1)Nc1nc(-c2ccoc2)c(C(=O)C2CCOCC2)s1",
"role": "assistant"
}
] |
1,530 | {
"selfies": [
"[C][C][Branch1][C][N][C][N][C][=C][C][Branch1][S][C][=C][C][=C][Branch1][Ring1][C][#N][C][Branch1][C][Cl][=C][Ring1][=Branch2][=N][Ring1][=C]",
"[O][=C][Branch1][C][O][C][=N][C][=C][C][=C][C][=C][Ring1][=Branch1][NH1][Ring1][=Branch2]",
"[C][N][Branch1][C][C][C][=O]"
],
"smiles": [
"CC(N)Cn1ccc(-c2ccc(C#N)c(Cl)c2)n1",
"O=C(O)c1nc2ccccc2[nH]1",
"CN(C)C=O"
]
} | CC(Cn1ccc(-c2ccc(C#N)c(Cl)c2)n1)NC(=O)c1nc2ccccc2[nH]1 | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the product of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the product molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Consider that for a chemical reaction, if <molecule_2d>.<molecule_2d>.<molecule_2d> is/are the reactants and reagents, what can be the product?",
"role": "user"
},
{
"content": "CC(Cn1ccc(-c2ccc(C#N)c(Cl)c2)n1)NC(=O)c1nc2ccccc2[nH]1",
"role": "assistant"
}
] |
1,531 | {
"selfies": [
"[C][S][=Branch1][C][=O][=Branch1][C][=O][Cl]",
"[O][C][C][C][C][C][C][N][Branch1][=C][C][=N][O][C][=C][C][=C][C][=C][Ring1][=Branch2][Ring1][=Branch1][C][C][N][Ring1][#C][C][Ring2][Ring1][Ring1]",
"[C][C][N][Branch1][Ring1][C][C][C][C]",
"[C][O]",
"[Cl][C][Cl]",
"[Cl][C][Cl]",
"[O]",
"[Cl-1]",
"[Cl-1]",
"[Cl-1]",
"[Cl-1]",
"[Cl-1]",
"[Cl-1]",
"[H+1]",
"[H+1]",
"[I-1]",
"[K+1]",
"[Pt]"
],
"smiles": [
"CS(=O)(=O)Cl",
"OCC1CCC2CN(c3noc4ccccc34)CCN2C1",
"CCN(CC)CC",
"CO",
"ClCCl",
"ClCCl",
"O",
"[Cl-]",
"[Cl-]",
"[Cl-]",
"[Cl-]",
"[Cl-]",
"[Cl-]",
"[H+]",
"[H+]",
"[I-]",
"[K+]",
"[Pt]"
]
} | CS(=O)(=O)OCC1CCC2CN(c3noc4ccccc34)CCN2C1 | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the product of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the product molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d> Considering the given starting materials, what might be the resulting product in a chemical reaction?",
"role": "user"
},
{
"content": "CS(=O)(=O)OCC1CCC2CN(c3noc4ccccc34)CCN2C1",
"role": "assistant"
}
] |
1,532 | {
"selfies": [
"[C][C][Branch1][C][C][Branch1][C][C][O][C][=Branch1][C][=O][N][C][C][N][Branch1][=Branch2][C][C][=C][C][C][C][Ring1][=Branch1][C][=C][C][=C][C][=C][Ring1][=Branch1][N][C][Ring1][P][=O]",
"[C]",
"[C][C][O]",
"[Pd]"
],
"smiles": [
"CC(C)(C)OC(=O)NC1CN(C2C=CCCC2)c2ccccc2NC1=O",
"C",
"CCO",
"[Pd]"
]
} | CC(C)(C)OC(=O)NC1CN(C2CCCCC2)c2ccccc2NC1=O | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the product of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the product molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "A chemical reaction has started with the substance(s) <molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d> as the reactants and reagents, what could be a probable product?",
"role": "user"
},
{
"content": "CC(C)(C)OC(=O)NC1CN(C2CCCCC2)c2ccccc2NC1=O",
"role": "assistant"
}
] |
1,533 | {
"selfies": [
"[O][=C][NH1][C][=N][C][C][Branch2][Ring1][Ring1][C][N][Branch1][=Branch1][C][C][C][C][O][C][C][=C][C][=C][C][=C][Ring1][=Branch1][=C][NH1][C][Ring2][Ring1][#Branch1][=Ring2][Ring1][Ring1]",
"[C][C][Branch1][C][C][O]",
"[Pd]"
],
"smiles": [
"O=c1[nH]cnc2c(CN(CCCCO)Cc3ccccc3)c[nH]c12",
"CC(C)O",
"[Pd]"
]
} | O=c1[nH]cnc2c(CNCCCCO)c[nH]c12 | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the product of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the product molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Using <molecule_2d>.<molecule_2d>.<molecule_2d> as the reactants and reagents, tell me the potential product.",
"role": "user"
},
{
"content": "O=c1[nH]cnc2c(CNCCCCO)c[nH]c12",
"role": "assistant"
}
] |
1,534 | {
"selfies": [
"[C][C][O][C][C][N][Ring1][=Branch1]",
"[C][C][Branch1][C][C][Branch1][C][C][O][C][=Branch1][C][=O][N][C][C][N][Branch1][O][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=O][C][C][Ring1][=C]",
"[C][C][O][C][Branch1][C][C][=O]",
"[C][O]",
"[BH3-1][C][#N]",
"[Na+1]"
],
"smiles": [
"C1COCCN1",
"CC(C)(C)OC(=O)N1CCN(c2ccccc2C=O)CC1",
"CCOC(C)=O",
"CO",
"[BH3-]C#N",
"[Na+]"
]
} | CC(C)(C)OC(=O)N1CCN(c2ccccc2CN2CCOCC2)CC1 | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the product of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the product molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Predict the product of a chemical reaction with <molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d> as the reactants and reagents.",
"role": "user"
},
{
"content": "CC(C)(C)OC(=O)N1CCN(c2ccccc2CN2CCOCC2)CC1",
"role": "assistant"
}
] |
1,535 | {
"selfies": [
"[Br][C][C][C][C][Ring1][Ring1]",
"[C][N][C][=C][Branch1][P][C][=C][C][=C][N][=C][Branch1][C][Br][C][=C][Ring1][#Branch1][NH1][Ring1][#Branch2][C][=N][Ring1][#C]",
"[C][C][C][O][C][Ring1][Branch1]",
"[C][C][O][C][Branch1][C][C][=O]",
"[C][N][Branch1][C][C][C][=O]",
"[C][Si][Branch1][C][C][Branch1][C][C][N-1][Si][Branch1][C][C][Branch1][C][C][C]",
"[C][C][=C][C][=C][C][=C][Ring1][=Branch1]",
"[Na+1]"
],
"smiles": [
"BrCC1CC1",
"Cn1cc(-c2cc3cnc(Br)cc3[nH]2)cn1",
"C1CCOC1",
"CCOC(C)=O",
"CN(C)C=O",
"C[Si](C)(C)[N-][Si](C)(C)C",
"Cc1ccccc1",
"[Na+]"
]
} | Cn1cc(-c2cc3cnc(Br)cc3n2CC2CC2)cn1 | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the product of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the product molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d> Given the above reactants and reagents, what could be a probable product of their reaction?",
"role": "user"
},
{
"content": "Cn1cc(-c2cc3cnc(Br)cc3n2CC2CC2)cn1",
"role": "assistant"
}
] |
1,536 | {
"selfies": [
"[C][N][C][=Branch1][C][=O][C][=C][C][C][=C][N][=C][Branch2][Ring2][Branch1][N][C][=C][C][=C][Branch2][Ring1][Branch2][N][C][C][N][Branch1][=C][C][=Branch1][C][=O][O][C][Branch1][C][C][Branch1][C][C][C][C][C][Ring1][=N][C][=N][Ring2][Ring1][Ring1][N][=C][Ring2][Ring1][#Branch2][N][Branch1][Branch2][C][C][C][C][C][Ring1][Branch1][C][=Ring2][Ring2][C][Ring2][Ring2][#Branch1]",
"[C][C][O][C][C][O][Ring1][=Branch1]",
"[C][C][O][C][C]",
"[C][O]",
"[Cl]"
],
"smiles": [
"Cn1c(=O)ccc2c3cnc(Nc4ccc(N5CCN(C(=O)OC(C)(C)C)CC5)cn4)nc3n(C3CCCC3)c21",
"C1COCCO1",
"CCOCC",
"CO",
"Cl"
]
} | Cn1c(=O)ccc2c3cnc(Nc4ccc(N5CCNCC5)cn4)nc3n(C3CCCC3)c21 | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the product of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the product molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d> Given the above reactants and reagents, what could be a probable product of their reaction?",
"role": "user"
},
{
"content": "Cn1c(=O)ccc2c3cnc(Nc4ccc(N5CCNCC5)cn4)nc3n(C3CCCC3)c21",
"role": "assistant"
}
] |
1,537 | {
"selfies": [
"[C][C][Branch1][C][C][Branch1][C][C][O][C][=Branch1][C][=O][N][C][=C][C][=C][Branch2][Ring1][=Branch2][C][=Branch1][C][=O][C][=C][C][C][N][Branch1][#Branch2][C][C][=C][C][=C][C][=C][Ring1][=Branch1][C][C][Ring1][=N][C][=C][Ring2][Ring1][=Branch1]",
"[C][O]",
"[C][O-1]",
"[Cl][C][Branch1][C][Cl][Cl]",
"[O][=C][Branch1][C][O][C][Branch1][C][F][Branch1][C][F][F]",
"[Na+1]"
],
"smiles": [
"CC(C)(C)OC(=O)Nc1ccc(C(=O)C=C2CCN(Cc3ccccc3)CC2)cc1",
"CO",
"C[O-]",
"ClC(Cl)Cl",
"O=C(O)C(F)(F)F",
"[Na+]"
]
} | Nc1ccc(C(=O)C=C2CCN(Cc3ccccc3)CC2)cc1 | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the product of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the product molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Can you tell me the potential product of a chemical reaction that uses <molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d> as the reactants and reagents?",
"role": "user"
},
{
"content": "Nc1ccc(C(=O)C=C2CCN(Cc3ccccc3)CC2)cc1",
"role": "assistant"
}
] |
1,538 | {
"selfies": [
"[C][C][O][C][Branch1][Ring2][O][C][C][C][Branch1][C][C][N][Branch1][S][C][C][=C][C][=C][C][=C][C][=C][C][=C][Ring1][#Branch2][Ring1][=Branch1][C][=Branch1][C][=O][C][Branch1][C][N][C][C][=C][C][=C][Branch1][#Branch2][O][C][Branch1][C][C][Branch1][C][C][C][C][=C][Ring1][O]",
"[C][N][Branch1][#Branch1][C][C][=Branch1][C][=O][O][N][C][=Branch1][C][=O][N][C][C][=C][C][=C][C][=C][Ring1][=Branch1]",
"[C][C][O][C][Branch1][C][C][=O]",
"[C][N][Branch1][C][C][C][=C][C][=N][C][=C][Ring1][=Branch1]",
"[Cl][C][Cl]",
"[O][C][=C][C][=C][C][NH1][N][=N][C][Ring1][=Branch2][=Ring1][Branch1]"
],
"smiles": [
"CCOC(OCC)C(C)N(Cc1cccc2ccccc12)C(=O)C(N)Cc1ccc(OC(C)(C)C)cc1",
"CN(CC(=O)O)NC(=O)NCc1ccccc1",
"CCOC(C)=O",
"CN(C)c1ccncc1",
"ClCCl",
"Oc1cccc2[nH]nnc12"
]
} | CCOC(OCC)C(C)N(Cc1cccc2ccccc12)C(=O)C(Cc1ccc(OC(C)(C)C)cc1)NC(=O)CN(C)NC(=O)NCc1ccccc1 | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the product of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the product molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Consider that for a chemical reaction, if <molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d> is/are the reactants and reagents, what can be the product?",
"role": "user"
},
{
"content": "CCOC(OCC)C(C)N(Cc1cccc2ccccc12)C(=O)C(Cc1ccc(OC(C)(C)C)cc1)NC(=O)CN(C)NC(=O)NCc1ccccc1",
"role": "assistant"
}
] |
1,539 | {
"selfies": [
"[N][C][C][C][C][C][C][Ring1][Branch1]",
"[O][=C][Branch1][C][O][C][=C][C][=C][C][=C][NH1][C][Ring1][Branch1][=C][Ring1][=Branch2]",
"[Cl][C][Cl]",
"[O][=C][Branch1][Branch2][N][C][=C][N][=C][Ring1][Branch1][N][C][=C][N][=C][Ring1][Branch1]"
],
"smiles": [
"NCC1CCCC1",
"O=C(O)c1ccc2cc[nH]c2c1",
"ClCCl",
"O=C(n1ccnc1)n1ccnc1"
]
} | O=C(NCC1CCCC1)c1ccc2cc[nH]c2c1 | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the product of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the product molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Propose a potential product given these reactants and reagents. <molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>",
"role": "user"
},
{
"content": "O=C(NCC1CCCC1)c1ccc2cc[nH]c2c1",
"role": "assistant"
}
] |
1,540 | {
"selfies": [
"[C][C][Branch1][C][C][Branch1][C][C][O][C][=Branch1][C][=O][N][C][Branch2][Ring2][P][C][=C][C][=C][Branch2][Ring2][Branch1][C][=C][Branch1][=Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][O][C][=C][Branch1][#C][C][=C][C][NH1][C][=Branch1][C][=O][NH1][C][=Ring1][=Branch1][Ring1][#Branch2][C][Ring2][Ring1][Ring2][=O][C][=C][Ring2][Ring1][O][C][C][C][Ring2][Ring1][#C]",
"[N][C][Branch2][Ring2][=C][C][=C][C][=C][Branch2][Ring2][C][C][=C][Branch1][=Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][O][C][=C][Branch1][N][C][=C][C][NH1][N][=C][C][=Ring1][Branch1][Ring1][=Branch2][C][Ring2][Ring1][Ring1][=O][C][=C][Ring2][Ring1][#Branch2][C][C][C][Ring2][Ring1][=C]"
],
"smiles": [
"CC(C)(C)OC(=O)NC1(c2ccc(-c3c(-c4ccccc4)oc4c(ccc5[nH]c(=O)[nH]c54)c3=O)cc2)CCC1",
"NC1(c2ccc(-c3c(-c4ccccc4)oc4c(ccc5[nH]ncc54)c3=O)cc2)CCC1"
]
} | NC1(c2ccc(-c3c(-c4ccccc4)oc4c(ccc5[nH]c(=O)[nH]c54)c3=O)cc2)CCC1 | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the product of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the product molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Consider that for a chemical reaction, if <molecule_2d>.<molecule_2d> is/are the reactants and reagents, what can be the product?",
"role": "user"
},
{
"content": "NC1(c2ccc(-c3c(-c4ccccc4)oc4c(ccc5[nH]c(=O)[nH]c54)c3=O)cc2)CCC1",
"role": "assistant"
}
] |
1,541 | {
"selfies": [
"[C][N][C][=N][C][Branch1][C][Cl][=N][C][Branch1][=Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][=N][Ring1][=N]",
"[O][=C][Branch1][C][O][C][C][C][N][C][C][Ring1][=Branch1]",
"[C][C][#N]",
"[O]",
"[Na+1]",
"[OH1-1]"
],
"smiles": [
"CNc1nc(Cl)nc(-c2ccccc2)n1",
"O=C(O)C1CCNCC1",
"CC#N",
"O",
"[Na+]",
"[OH-]"
]
} | CNc1nc(-c2ccccc2)nc(N2CCC(C(=O)O)CC2)n1 | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the product of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the product molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d> Based on the reactants and reagents given above, suggest a possible product.",
"role": "user"
},
{
"content": "CNc1nc(-c2ccccc2)nc(N2CCC(C(=O)O)CC2)n1",
"role": "assistant"
}
] |
1,542 | {
"selfies": [
"[Cl][C][=C][C][=C][C][=C][N][=C][Branch1][C][Cl][C][Ring1][#Branch1][=C][Ring1][O]",
"[C][=C][C][=C][Branch1][#Branch2][C][N][C][C][N][C][C][Ring1][=Branch1][C][=C][Ring1][=N]",
"[O]"
],
"smiles": [
"Clc1ccc2ccnc(Cl)c2c1",
"c1ccc(CN2CCNCC2)cc1",
"O"
]
} | Clc1ccc2ccnc(N3CCN(Cc4ccccc4)CC3)c2c1 | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the product of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the product molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Propose a potential product given these reactants and reagents. <molecule_2d>.<molecule_2d>.<molecule_2d>",
"role": "user"
},
{
"content": "Clc1ccc2ccnc(N3CCN(Cc4ccccc4)CC3)c2c1",
"role": "assistant"
}
] |
1,543 | {
"selfies": [
"[C][C][Branch1][C][C][Branch1][C][C][O][C][=Branch1][C][=O][N][C][C][O][C][=N][C][Branch1][C][Cl][=C][C][=C][Ring1][#Branch1][C][Ring1][N]",
"[C][C][Branch1][C][O][C][C][C][C][C][Ring1][Branch1]",
"[C][C][=C][C][=C][C][=C][Ring1][=Branch1]",
"[O]",
"[O][=C][Branch1][O][C][=C][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=C][C][=C][C][=C][C][=C][Ring1][=Branch1]",
"[O][=C][Branch1][O][C][=C][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=C][C][=C][C][=C][C][=C][Ring1][=Branch1]",
"[O][=C][Branch1][O][C][=C][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=C][C][=C][C][=C][C][=C][Ring1][=Branch1]",
"[H-1]",
"[Na+1]",
"[Pd]",
"[Pd]",
"[C][=C][C][=C][Branch2][Branch1][#C][P][Branch1][=Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=C][C][=C][C][=C][C][=C][C][Ring1][=Branch1][=C][Ring1][#Branch2][C][=C][Branch2][Ring1][Ring2][P][Branch1][=Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=C][C][=C][C][=C][C][=C][Ring2][Ring1][#Branch1][Ring1][=Branch1][C][=C][Ring2][Ring2][=C]"
],
"smiles": [
"CC(C)(C)OC(=O)N1CCOc2nc(Cl)ccc2C1",
"CC(O)C1CCCC1",
"Cc1ccccc1",
"O",
"O=C(C=Cc1ccccc1)C=Cc1ccccc1",
"O=C(C=Cc1ccccc1)C=Cc1ccccc1",
"O=C(C=Cc1ccccc1)C=Cc1ccccc1",
"[H-]",
"[Na+]",
"[Pd]",
"[Pd]",
"c1ccc(P(c2ccccc2)c2ccc3ccccc3c2-c2c(P(c3ccccc3)c3ccccc3)ccc3ccccc23)cc1"
]
} | CC(Oc1ccc2c(n1)OCCN(C(=O)OC(C)(C)C)C2)C1CCCC1 | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the product of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the product molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Consider that for a chemical reaction, if <molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d> is/are the reactants and reagents, what can be the product?",
"role": "user"
},
{
"content": "CC(Oc1ccc2c(n1)OCCN(C(=O)OC(C)(C)C)C2)C1CCCC1",
"role": "assistant"
}
] |
1,544 | {
"selfies": [
"[C][O][C][=Branch1][C][=O][C][N][C][C][Branch1][C][C][C][N][Branch1][S][C][=C][Branch1][C][Cl][C][=C][Branch1][C][Cl][C][=C][Ring1][Branch2][Cl][S][Ring1][S][=Branch1][C][=O][=O]",
"[C][C][C][O][C][Ring1][Branch1]",
"[C][O]",
"[O]",
"[Li+1]",
"[OH1-1]"
],
"smiles": [
"COC(=O)CN1CC(C)CN(c2c(Cl)cc(Cl)cc2Cl)S1(=O)=O",
"C1CCOC1",
"CO",
"O",
"[Li+]",
"[OH-]"
]
} | CC1CN(CC(=O)O)S(=O)(=O)N(c2c(Cl)cc(Cl)cc2Cl)C1 | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the product of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the product molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Consider that for a chemical reaction, if <molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d> is/are the reactants and reagents, what can be the product?",
"role": "user"
},
{
"content": "CC1CN(CC(=O)O)S(=O)(=O)N(c2c(Cl)cc(Cl)cc2Cl)C1",
"role": "assistant"
}
] |
1,545 | {
"selfies": [
"[C][C][C][C][C][C][=Branch1][C][=O][Cl]",
"[O][C][=C][C][=C][Branch2][Branch1][O][C][=C][C][=C][Branch2][Ring2][#C][C][=C][C][=C][Branch1][O][C][=C][C][=C][C][=C][Ring1][#Branch2][Ring1][=Branch1][C][=C][C][Branch1][=Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][Branch1][N][C][=C][C][=C][Branch1][C][F][C][=C][Ring1][#Branch1][O][Ring2][Ring1][=Branch2][C][=C][Ring2][Ring1][P][C][=C][Ring2][Ring2][#Branch1]",
"[Cl]",
"[Cl][C][Cl]",
"[C][=C][C][=N][C][=C][Ring1][=Branch1]"
],
"smiles": [
"CCCCCC(=O)Cl",
"Oc1ccc(-c2ccc(-c3cc4c(c5ccccc35)C=CC(c3ccccc3)(c3ccc(F)cc3)O4)cc2)cc1",
"Cl",
"ClCCl",
"c1ccncc1"
]
} | CCCCCC(=O)Oc1ccc(-c2ccc(-c3cc4c(c5ccccc35)C=CC(c3ccccc3)(c3ccc(F)cc3)O4)cc2)cc1 | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the product of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the product molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Based on the given reactants and reagents: <molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>, what product could potentially be produced?",
"role": "user"
},
{
"content": "CCCCCC(=O)Oc1ccc(-c2ccc(-c3cc4c(c5ccccc35)C=CC(c3ccccc3)(c3ccc(F)cc3)O4)cc2)cc1",
"role": "assistant"
}
] |
1,546 | {
"selfies": [
"[C][O][C][=Branch1][C][=O][C][C][C][C][C][Branch2][Branch1][#Branch1][N][C][C][=C][C][=C][Branch2][Ring2][Ring2][C][=C][C][=C][Branch2][Ring1][Branch2][N][C][=Branch1][C][=O][C][N][=C][Branch1][=Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][O][C][=Ring1][O][C][C][=C][Ring2][Ring1][Branch1][C][=C][Ring2][Ring1][O][C][Ring2][Ring1][=C][=O][C][Ring2][Ring2][Branch1]",
"[C][C][Branch1][C][C][C][Branch1][=Branch1][C][=Branch1][C][=O][O][N][C][C][=C][C][=C][Branch2][Ring1][Branch2][C][=C][C][=C][Branch1][=C][N][C][=Branch1][C][=O][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=C][Ring1][#C][C][=C][Ring2][Ring1][Branch1][C][Ring2][Ring1][Branch2][=O]"
],
"smiles": [
"COC(=O)C1CCCC(N2Cc3ccc(-c4ccc(NC(=O)c5nc(-c6ccccc6)oc5C)cc4)cc3C2=O)C1",
"CC(C)C(C(=O)O)N1Cc2ccc(-c3ccc(NC(=O)c4ccccc4)cc3)cc2C1=O"
]
} | Cc1oc(-c2ccccc2)nc1C(=O)Nc1ccc(-c2ccc3c(c2)C(=O)N(C2CCCC(C(=O)O)C2)C3)cc1 | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the product of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the product molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "<molecule_2d>.<molecule_2d> Given the above reactants and reagents, what could be a probable product of their reaction?",
"role": "user"
},
{
"content": "Cc1oc(-c2ccccc2)nc1C(=O)Nc1ccc(-c2ccc3c(c2)C(=O)N(C2CCCC(C(=O)O)C2)C3)cc1",
"role": "assistant"
}
] |
1,547 | {
"selfies": [
"[C][C][Branch1][C][C][Branch1][C][C][O][C][=Branch1][C][=O][N][C][C][C][C][C][C][=Branch1][C][=O][O]",
"[C][N][C][C][N][C][C][C][Branch2][Ring1][#Branch1][O][C][=Branch1][C][=O][N][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=C][C][=C][C][=C][Ring1][=Branch1][C][C][Ring2][Ring1][=Branch1]",
"[C][C][Branch1][C][C][Branch1][C][C][C][=Branch1][C][=O][Cl]",
"[C][C][N][Branch1][Ring1][C][C][C][C]",
"[Cl][C][Cl]"
],
"smiles": [
"CC(C)(C)OC(=O)NCCCCCC(=O)O",
"CNCCN1CCC(OC(=O)Nc2ccccc2-c2ccccc2)CC1",
"CC(C)(C)C(=O)Cl",
"CCN(CC)CC",
"ClCCl"
]
} | CN(CCN1CCC(OC(=O)Nc2ccccc2-c2ccccc2)CC1)C(=O)CCCCCNC(=O)OC(C)(C)C | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the product of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the product molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Please provide a feasible product that could be formed using these reactants and reagents: <molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d> .",
"role": "user"
},
{
"content": "CN(CCN1CCC(OC(=O)Nc2ccccc2-c2ccccc2)CC1)C(=O)CCCCCNC(=O)OC(C)(C)C",
"role": "assistant"
}
] |
1,548 | {
"selfies": [
"[C][C][C][C][=N][N][Branch1][C][C][C][C][=Branch1][C][=O][NH1][C][Branch2][Ring1][Ring2][C][=C][C][Branch1][=Branch2][S][=Branch1][C][=O][=Branch1][C][=O][Cl][=C][C][=C][Ring1][#Branch2][O][=N][C][Ring2][Ring1][=Branch1][=Ring2][Ring1][C]",
"[C][N][C][C][N][C][C][Ring1][=Branch1]",
"[C][C][O]"
],
"smiles": [
"CCCc1nn(C)c2c(=O)[nH]c(-c3cc(S(=O)(=O)Cl)ccc3O)nc12",
"CN1CCNCC1",
"CCO"
]
} | CCCc1nn(C)c2c(=O)[nH]c(-c3cc(S(=O)(=O)N4CCN(C)CC4)ccc3O)nc12 | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the product of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the product molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Can you tell me the potential product of a chemical reaction that uses <molecule_2d>.<molecule_2d>.<molecule_2d> as the reactants and reagents?",
"role": "user"
},
{
"content": "CCCc1nn(C)c2c(=O)[nH]c(-c3cc(S(=O)(=O)N4CCN(C)CC4)ccc3O)nc12",
"role": "assistant"
}
] |
1,549 | {
"selfies": [
"[C][C][C][C][=C][Branch2][Ring1][=Branch1][C][C][=C][C][=C][Branch1][O][C][=C][C][=C][C][=C][Ring1][=Branch1][C][#N][C][=C][Ring1][=C][C][=Branch1][C][=O][N][Branch2][Ring1][=Branch1][C][=C][C][=C][C][=Branch1][Ring2][=C][Ring1][=Branch1][C][C][Branch1][C][C][Branch1][C][C][O][Ring1][Branch2][C][=N][C][=N][N][Ring2][Ring2][Ring2][Ring1][Branch1]",
"[O][=C][Branch1][C][O-1][O]",
"[NH3+1][O]",
"[C][C][O][C][Branch1][C][C][=O]",
"[C][S][Branch1][C][C][=O]",
"[Cl-1]",
"[Na+1]"
],
"smiles": [
"CCCc1c(Cc2ccc(-c3ccccc3C#N)cc2)c(=O)n(-c2ccc3c(c2)CC(C)(C)O3)c2ncnn12",
"O=C([O-])O",
"[NH3+]O",
"CCOC(C)=O",
"CS(C)=O",
"[Cl-]",
"[Na+]"
]
} | CCCc1c(Cc2ccc(-c3ccccc3-c3noc(=O)[nH]3)cc2)c(=O)n(-c2ccc3c(c2)CC(C)(C)O3)c2ncnn12 | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the product of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the product molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Consider that for a chemical reaction, if <molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d> is/are the reactants and reagents, what can be the product?",
"role": "user"
},
{
"content": "CCCc1c(Cc2ccc(-c3ccccc3-c3noc(=O)[nH]3)cc2)c(=O)n(-c2ccc3c(c2)CC(C)(C)O3)c2ncnn12",
"role": "assistant"
}
] |
1,550 | {
"selfies": [
"[C][N][C][=Branch1][C][=O][N][Branch2][Ring1][#Branch1][C][Branch1][C][C][C][C][N][Branch1][#Branch2][C][C][=C][C][=C][C][=C][Ring1][=Branch1][C][C][Ring1][=C][C][=C][C][=C][C][=C][Ring1][=Branch1][Ring2][Ring1][Branch2]",
"[C][O]",
"[Pd]"
],
"smiles": [
"Cn1c(=O)n(C2(C)CCN(Cc3ccccc3)CC2)c2ccccc21",
"CO",
"[Pd]"
]
} | Cn1c(=O)n(C2(C)CCNCC2)c2ccccc21 | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the product of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the product molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "<molecule_2d>.<molecule_2d>.<molecule_2d> Considering the given starting materials, what might be the resulting product in a chemical reaction?",
"role": "user"
},
{
"content": "Cn1c(=O)n(C2(C)CCNCC2)c2ccccc21",
"role": "assistant"
}
] |
1,551 | {
"selfies": [
"[C][=C][C][=Branch1][C][=O][Cl]",
"[O][=C][C][=C][C][=C][C][=C][C][=C][C][=C][C][=C][C][Branch2][Ring1][=C][C][=C][C][=C][Branch1][#Branch2][C][Ring2][Ring1][C][=C][Ring1][S][Ring1][=Branch1][C][=Branch1][C][=O][N][Ring2][Ring1][#Branch1][C][C][C][C][C][O][=C][Ring2][Ring1][Branch1][Ring2][Ring1][=Branch2]",
"[C][C][O][C][C][O][Ring1][=Branch1]",
"[Cl][C][Cl]",
"[C][=C][C][=N][C][=C][Ring1][=Branch1]"
],
"smiles": [
"C=CC(=O)Cl",
"O=C1c2ccc3c4cccc5cccc(c6ccc(c2c36)C(=O)N1CCCCCO)c54",
"C1COCCO1",
"ClCCl",
"c1ccncc1"
]
} | C=CC(=O)OCCCCCN1C(=O)c2ccc3c4cccc5cccc(c6ccc(c2c36)C1=O)c54 | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the product of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the product molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d> Given the above reactants and reagents, what could be a probable product of their reaction?",
"role": "user"
},
{
"content": "C=CC(=O)OCCCCCN1C(=O)c2ccc3c4cccc5cccc(c6ccc(c2c36)C1=O)c54",
"role": "assistant"
}
] |
1,552 | {
"selfies": [
"[C][C][Branch1][C][N][C][C][=C][Branch1][C][F][C][Branch1][C][F][=C][C][Branch1][C][F][=C][Ring1][=Branch2][F]",
"[C][C][=C][C][=Branch2][Ring1][=Branch2][=C][C][NH1][C][Branch1][=N][C][=C][Branch1][C][Cl][C][=C][NH1][C][Ring1][#Branch1][=O][=N][C][Ring1][P][=Ring1][=N][C][=Branch1][C][=O][N][Branch1][Branch2][C][C][N][Branch1][C][C][C][C][Ring2][Ring1][=Branch2][=O]",
"[C][C][C][C][O]",
"[C][C][N][Branch1][=Branch1][C][Branch1][C][C][C][C][Branch1][C][C][C]"
],
"smiles": [
"CC(N)Cc1c(F)c(F)cc(F)c1F",
"Cc1c2c(cc3[nH]c(-c4c(Cl)cc[nH]c4=O)nc13)C(=O)N(CCN(C)C)C2=O",
"CCCCO",
"CCN(C(C)C)C(C)C"
]
} | Cc1c2c(cc3[nH]c(-c4c(NC(C)Cc5c(F)c(F)cc(F)c5F)cc[nH]c4=O)nc13)C(=O)N(CCN(C)C)C2=O | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the product of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the product molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d> Considering the given starting materials, what might be the resulting product in a chemical reaction?",
"role": "user"
},
{
"content": "Cc1c2c(cc3[nH]c(-c4c(NC(C)Cc5c(F)c(F)cc(F)c5F)cc[nH]c4=O)nc13)C(=O)N(CCN(C)C)C2=O",
"role": "assistant"
}
] |
1,553 | {
"selfies": [
"[C][C][O][C][=Branch1][C][=O][C][=C][C][=C][C][Branch1][P][C][=C][C][=C][N][=C][Branch1][C][N][S][C][Ring1][=Branch1][=N][Ring1][#Branch2][=C][Ring1][S]",
"[C][C][C][O][C][Ring1][Branch1]",
"[C][O]",
"[Cl]",
"[O]",
"[O]",
"[Li+1]",
"[OH1-1]"
],
"smiles": [
"CCOC(=O)c1cccc(-c2ccc3nc(N)sc3n2)c1",
"C1CCOC1",
"CO",
"Cl",
"O",
"O",
"[Li+]",
"[OH-]"
]
} | Nc1nc2ccc(-c3cccc(C(=O)O)c3)nc2s1 | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the product of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the product molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d> Based on the reactants and reagents given above, suggest a possible product.",
"role": "user"
},
{
"content": "Nc1nc2ccc(-c3cccc(C(=O)O)c3)nc2s1",
"role": "assistant"
}
] |