conversations
stringlengths
109
9.01k
[{"from": "human", "value": "Given compound, write its InChI. -> Methocarbamol\n"}, {"from": "gpt", "value": " InChI=1S/C11H15NO5/c1-15-9-4-2-3-5-10(9)16-6-8(13)7-17-11(12)14/h2-5,8,13H,6-7H2,1H3,(H2,12,14)\n"}]
[{"from": "human", "value": "Write InChI of given compound. -> Benzo[ghi]perylene\n"}, {"from": "gpt", "value": " InChI=1S/C22H12/c1-3-13-7-9-15-11-12-16-10-8-14-4-2-6-18-17(5-1)19(13)21(15)22(16)20(14)18/h1-12H\n"}]
[{"from": "human", "value": "Write compound of given InChI. -> InChI=1S/C8H10O/c1-6-4-3-5-7(2)8(6)9/h3-5,9H,1-2H3\n"}, {"from": "gpt", "value": " 2,6-Dimethylphenol\n"}]
[{"from": "human", "value": "Write compound of given InChI. -> InChI=1S/C8H8Cl2IO3PS/c1-12-15(16,13-2)14-8-4-5(9)7(11)3-6(8)10/h3-4H,1-2H3\n"}, {"from": "gpt", "value": " Iodofenphos\n"}]
[{"from": "human", "value": "Given SMILES, write its aqueous solubility expressed as a logarithm in mol/L in room temperature. -> COC(C)(C)C\n"}, {"from": "gpt", "value": " -0.24\n"}]
[{"from": "human", "value": "Given compound, write its potential SMILES. -> Isocarboxazid\n"}, {"from": "gpt", "value": " Cc1cc(no1)C(=O)NNCc2ccccc2\n"}]
[{"from": "human", "value": "Write compound of given SMILES. -> ClCBr\n"}, {"from": "gpt", "value": " Bromochloromethane\n"}]
[{"from": "human", "value": "Write compound of given SMILES. -> Cc2ncc1nccnc1n2\n"}, {"from": "gpt", "value": " 2-methylpteridine\n"}]
[{"from": "human", "value": "Write aqueous solubility of given SMILES in 25 \u00b0C. -> Clc1cccc2ccccc12\n"}, {"from": "gpt", "value": " 0.0001174897554939529 mol/L\n"}]
[{"from": "human", "value": "What is compound of given SELFIES? -> [C][C][=C][C][Branch1][C][C][=C][Branch1][C][O][C][Branch1][C][C][=C][Ring1][=Branch2]\n"}, {"from": "gpt", "value": " 2,4,6-Trimethylphenol\n"}]
[{"from": "human", "value": "Write aqueous solubility of given SELFIES in 25 \u00b0C. -> [C][C][=Branch1][C][=C][C]\n"}, {"from": "gpt", "value": " 0.004677351412871981 mol/L\n"}]
[{"from": "human", "value": "What is compound of given InChI? -> InChI=1S/C12H27OPS3/c1-4-7-10-15-14(13,16-11-8-5-2)17-12-9-6-3/h4-12H2,1-3H3\n"}, {"from": "gpt", "value": " DEF\n"}]
[{"from": "human", "value": "Write water solubility expressed as a logarithm in mol/L of given InChI in 25 \u00b0C. -> InChI=1S/C5H6N2OS/c1-3-2-4(8)7-5(9)6-3/h2H,1H3,(H2,6,7,8,9)\n"}, {"from": "gpt", "value": " -2.436\n"}]
[{"from": "human", "value": "Given InChI, write its aqueous solubility in room temperature. -> InChI=1S/C11H16ClO2PS3/c1-3-13-15(16,14-4-2)18-9-17-11-7-5-10(12)6-8-11/h5-8H,3-4,9H2,1-2H3\n"}, {"from": "gpt", "value": " 1.8365383433483438e-06 mol/L\n"}]
[{"from": "human", "value": "Given SELFIES, write its compound. -> [C][C][C][C][Branch1][C][O][C][C][C]\n"}, {"from": "gpt", "value": " 4-Heptanol\n"}]
[{"from": "human", "value": "Write a possible SELFIES of given compound. -> 2-Bromotoluene\n"}, {"from": "gpt", "value": " [C][C][=C][C][=C][C][=C][Ring1][=Branch1][Br]\n"}]
[{"from": "human", "value": "Write a possible SMILES of given compound. -> 2-Methyl-2-hexanol\n"}, {"from": "gpt", "value": " CCCCC(C)(C)O\n"}]
[{"from": "human", "value": "What will be SMILES of given compound? -> Carbaryl\n"}, {"from": "gpt", "value": " CNC(=O)Oc1cccc2ccccc12\n"}]
[{"from": "human", "value": "What is InChI of given compound? -> 2,2',3,4,4',5',6-PCB\n"}, {"from": "gpt", "value": " InChI=1S/C12H3Cl7/c13-4-1-2-5(6(14)3-4)7-8(15)10(17)12(19)11(18)9(7)16/h1-3H\n"}]
[{"from": "human", "value": "Write water solubility expressed as a logarithm in mol/L of given SELFIES in 25 \u00b0C. -> [O][C][=C][C][=C][C][=C][Ring1][=Branch1][Cl]\n"}, {"from": "gpt", "value": " -1.06\n"}]
[{"from": "human", "value": "Given InChI, write its water solubility expressed as a logarithm in mol/L in room temperature. -> InChI=1S/C7H8O/c1-6-3-2-4-7(8)5-6/h2-5,8H,1H3\n"}, {"from": "gpt", "value": " -0.68\n"}]
[{"from": "human", "value": "Given SELFIES, write its water solubility expressed as a logarithm in mol/L in 25 \u00b0C. -> [C][S][C][=N][C][=Branch1][=N][=N][C][=Branch1][Ring2][=N][Ring1][=Branch1][N][Branch1][C][C][C][N][Branch1][C][C][C]\n"}, {"from": "gpt", "value": " -2.676\n"}]
[{"from": "human", "value": "Write a possible SELFIES of given compound. -> Clonazepam\n"}, {"from": "gpt", "value": " [Cl][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=N][C][C][=Branch1][C][=O][N][C][=C][C][=C][Branch1][#Branch1][C][=C][Ring1][N][Ring1][=Branch1][N][=Branch1][C][=O][=O]\n"}]
[{"from": "human", "value": "Given SELFIES, write its compound. -> [N][C][=C][C][=C][Branch1][Branch1][C][=C][Ring1][=Branch1][C][=C][C][=C][Branch1][C][N][C][=C][Ring1][#Branch1]\n"}, {"from": "gpt", "value": " p,p'-Biphenyldiamine \n"}]
[{"from": "human", "value": "What will be SMILES of given compound? -> Diazinon\n"}, {"from": "gpt", "value": " CCOP(=S)(OCC)Oc1cc(C)nc(n1)C(C)C\n"}]
[{"from": "human", "value": "Write water solubility of given compound in 25 \u00b0C. -> Chrysene\n"}, {"from": "gpt", "value": " 8.770008211436339e-09 mol/L\n"}]
[{"from": "human", "value": "Write compound of given SELFIES. -> [C][C][C][C][C][C][Ring1][=Branch1]\n"}, {"from": "gpt", "value": " Cyclohexane\n"}]
[{"from": "human", "value": "What is compound of given InChI? -> InChI=1S/C8H10O/c1-7(9)8-5-3-2-4-6-8/h2-7,9H,1H3\n"}, {"from": "gpt", "value": " 1-Phenylethanol\n"}]
[{"from": "human", "value": "Given SMILES, write its compound. -> CCC(C)Cl\n"}, {"from": "gpt", "value": " 2-Chlorobutane\n"}]
[{"from": "human", "value": "Given compound, write its potential SELFIES. -> Dulcin\n"}, {"from": "gpt", "value": " [C][C][O][C][=C][C][=C][Branch1][#Branch1][N][C][Branch1][C][N][=O][C][=C][Ring1][#Branch2]\n"}]
[{"from": "human", "value": "Write aqueous solubility expressed as a logarithm in mol/L of given SMILES in 25 \u00b0C. -> CNC(=O)ON=C(SC)C(=O)N(C)C\n"}, {"from": "gpt", "value": " 0.106\n"}]
[{"from": "human", "value": "Given compound, write its potential SELFIES. -> 17a-Methyltestosterone\n"}, {"from": "gpt", "value": " [C][C][Branch1][C][O][C][C][C][C][C][C][C][=C][C][=Branch1][C][=O][C][C][C][Ring1][#Branch1][Branch1][C][C][C][Ring1][N][C][C][C][Ring1][S][Ring2][Ring1][Ring2][C]\n"}]
[{"from": "human", "value": "Given compound, write its water solubility expressed as a logarithm in mol/L in 25 \u00b0C. -> 2,4-Dimethylpyridine\n"}, {"from": "gpt", "value": " 0.38\n"}]
[{"from": "human", "value": "Write water solubility expressed as a logarithm in mol/L of given InChI in room temperature. -> InChI=1S/C2Cl3F3/c3-1(4,6)2(5,7)8\n"}, {"from": "gpt", "value": " -3.04\n"}]
[{"from": "human", "value": "Given SMILES, write its water solubility in room temperature. -> CCCCCC1CCCC1\n"}, {"from": "gpt", "value": " 8.317637711026709e-07 mol/L\n"}]
[{"from": "human", "value": "Write a possible SELFIES of given compound. -> Phosalone\n"}, {"from": "gpt", "value": " [C][C][O][P][=Branch1][C][=S][Branch1][Ring2][O][C][C][S][C][N][C][=Branch1][C][=O][O][C][=C][C][Branch1][C][Cl][=C][C][=C][Ring1][O][Ring1][#Branch1]\n"}]
[{"from": "human", "value": "Write InChI of given compound. -> Bromoethane\n"}, {"from": "gpt", "value": " InChI=1S/C2H5Br/c1-2-3/h2H2,1H3\n"}]
[{"from": "human", "value": "Given InChI, write its compound. -> InChI=1S/C19H18N2O3/c1-14(22)12-13-17-18(23)20(15-8-4-2-5-9-15)21(19(17)24)16-10-6-3-7-11-16/h2-11,17H,12-13H2,1H3\n"}, {"from": "gpt", "value": " kebuzone\n"}]
[{"from": "human", "value": "Given compound, write its potential SMILES. -> phthalamide\n"}, {"from": "gpt", "value": " c1cC2C(=O)NC(=O)C2cc1\n"}]
[{"from": "human", "value": "Given SMILES, write its compound. -> CC(O)C(C)(C)C\n"}, {"from": "gpt", "value": " 3,3-Dimethyl-2-butanol\n"}]
[{"from": "human", "value": "Write a possible SELFIES of given compound. -> Cypermethrin\n"}, {"from": "gpt", "value": " [C][C][Branch1][C][C][C][Branch1][#Branch1][C][=C][Branch1][C][Cl][Cl][C][Ring1][Branch2][C][=Branch1][C][=O][O][C][Branch1][Ring1][C][#N][C][=C][C][=C][C][Branch1][#Branch2][O][C][=C][C][=C][C][=C][Ring1][=Branch1][=C][Ring1][=N]\n"}]
[{"from": "human", "value": "What will be SMILES of given compound? -> 2,3-Dimethylpyridine\n"}, {"from": "gpt", "value": " Cc1cccnc1C\n"}]
[{"from": "human", "value": "Given SELFIES, write its aqueous solubility expressed as a logarithm in mol/L in 25 \u00b0C. -> [C][C][#C]\n"}, {"from": "gpt", "value": " -0.41\n"}]
[{"from": "human", "value": "What is InChI of given compound? -> Ethyl acetate\n"}, {"from": "gpt", "value": " InChI=1S/C4H8O2/c1-3-6-4(2)5/h3H2,1-2H3\n"}]
[{"from": "human", "value": "Given SELFIES, write its compound. -> [C][=C][C][=C][NH1][C][=C][C][Ring1][Branch1][=C][Ring1][=Branch2]\n"}, {"from": "gpt", "value": " Indole\n"}]
[{"from": "human", "value": "Given compound, write its potential SELFIES. -> 1,2-Propylene oxide\n"}, {"from": "gpt", "value": " [C][C][C][O][Ring1][Ring1]\n"}]
[{"from": "human", "value": "What is water solubility expressed as a logarithm in mol/L of given compound in 25 \u00b0C? -> 1-Propanol\n"}, {"from": "gpt", "value": " 0.62\n"}]
[{"from": "human", "value": "Given SELFIES, write its compound. -> [C][C][C][Branch1][C][O][C][C]\n"}, {"from": "gpt", "value": " 3-Pentanol\n"}]
[{"from": "human", "value": "Write a possible SMILES of given compound. -> Caproaldehyde\n"}, {"from": "gpt", "value": " CCCCCC=O\n"}]
[{"from": "human", "value": "Given compound, write its aqueous solubility in room temperature. -> Buturon\n"}, {"from": "gpt", "value": " 0.00012589254117941674 mol/L\n"}]
[{"from": "human", "value": "Write water solubility expressed as a logarithm in mol/L of given SELFIES in room temperature. -> [Cl][C][C][Branch1][C][C][C]\n"}, {"from": "gpt", "value": " -2.0\n"}]
[{"from": "human", "value": "Write a possible SMILES of given compound. -> Norethisterone\n"}, {"from": "gpt", "value": " CC34CCC1C(CCC2=CC(=O)CCC12O)C3CCC4(O)C#C\n"}]
[{"from": "human", "value": "What is aqueous solubility of given SMILES in 25 \u00b0C? -> O=N(=O)c1ccc(cc1)N(=O)=O\n"}, {"from": "gpt", "value": " 0.0004073802778041126 mol/L\n"}]
[{"from": "human", "value": "What is compound of given InChI? -> InChI=1S/C7H8N2S/c8-7(10)9-6-4-2-1-3-5-6/h1-5H,(H3,8,9,10)\n"}, {"from": "gpt", "value": " Phenylthiourea\n"}]
[{"from": "human", "value": "What will be SMILES of given compound? -> Caffeine\n"}, {"from": "gpt", "value": " Cn1cnc2n(C)c(=O)n(C)c(=O)c12\n"}]
[{"from": "human", "value": "Given InChI, write its compound. -> InChI=1S/C17H12/c1-3-7-14-12(5-1)9-10-16-15-8-4-2-6-13(15)11-17(14)16/h1-10H,11H2\n"}, {"from": "gpt", "value": " Benzo(a)fluorene\n"}]
[{"from": "human", "value": "What is water solubility expressed as a logarithm in mol/L of given SMILES in 25 \u00b0C? -> C1C(O)CCC2(C)CC3CCC4(C)C5(C)CC6OCC(C)CC6OC5CC4C3C=C21\n"}, {"from": "gpt", "value": " -7.32\n"}]
[{"from": "human", "value": "Write compound of given InChI. -> InChI=1S/C9H10O2/c1-2-11-9(10)8-6-4-3-5-7-8/h3-7H,2H2,1H3\n"}, {"from": "gpt", "value": " Ethyl benzoate \n"}]
[{"from": "human", "value": "Write InChI of given compound. -> 1,2-Dinitrobenzene\n"}, {"from": "gpt", "value": " InChI=1S/C6H4N2O4/c9-7(10)5-3-1-2-4-6(5)8(11)12/h1-4H\n"}]
[{"from": "human", "value": "What is compound of given SELFIES? -> [C][C][C][Branch1][Ring1][C][C][C][=O]\n"}, {"from": "gpt", "value": " 2-Ethylbutanal\n"}]
[{"from": "human", "value": "Write compound of given SMILES. -> CC34CCC1C(CCC2CC(O)CCC12C)C3CCC4=O\n"}, {"from": "gpt", "value": " Epiandrosterone\n"}]
[{"from": "human", "value": "Write a possible SELFIES of given compound. -> 2-pyrrolidone\n"}, {"from": "gpt", "value": " [O][=C][C][C][C][N][Ring1][Branch1]\n"}]
[{"from": "human", "value": "Given SMILES, write its water solubility in 25 \u00b0C. -> CNC(=O)Oc1ccccc1C2OCCO2\n"}, {"from": "gpt", "value": " 0.026915348039269153 mol/L\n"}]
[{"from": "human", "value": "What is aqueous solubility expressed as a logarithm in mol/L of given SMILES in room temperature? -> CCO\n"}, {"from": "gpt", "value": " 1.1\n"}]
[{"from": "human", "value": "Write compound of given SELFIES. -> [C][C][C][C][C][C][C][C][C][C][C][C][=Branch1][C][=O][O][C]\n"}, {"from": "gpt", "value": " methyl laurate\n"}]
[{"from": "human", "value": "What will be SMILES of given compound? -> thioanisole\n"}, {"from": "gpt", "value": " c1ccccc1SC\n"}]
[{"from": "human", "value": "What is compound of given SMILES? -> c1(C(C)(C)C)cc(C(C)(C)C)cc(OC(=O)NC)c1\n"}, {"from": "gpt", "value": " butacarb\n"}]
[{"from": "human", "value": "What is aqueous solubility of given SELFIES in 25 \u00b0C? -> [Br][C][=C][C][=C][C][=C][Ring1][=Branch1][Br]\n"}, {"from": "gpt", "value": " 0.00031622776601683794 mol/L\n"}]
[{"from": "human", "value": "What is water solubility of given compound in 25 \u00b0C? -> Butylbenzene\n"}, {"from": "gpt", "value": " 8.709635899560814e-05 mol/L\n"}]
[{"from": "human", "value": "What will be SELFIES of given compound? -> 1,3-Dibromobenzene\n"}, {"from": "gpt", "value": " [Br][C][=C][C][=C][C][Branch1][C][Br][=C][Ring1][#Branch1]\n"}]
[{"from": "human", "value": "What is compound of given SELFIES? -> [C][C][O][C][=C][C][=Ring1][Branch1][C][=Branch1][C][=O][N][C][=C][C][=C][C][=C][Ring1][=Branch1]\n"}, {"from": "gpt", "value": " Fenfuram\n"}]
[{"from": "human", "value": "Given SMILES, write its compound. -> CCOC(=O)c1ccc(O)cc1\n"}, {"from": "gpt", "value": " Ethyl-p-hydroxybenzoate \n"}]
[{"from": "human", "value": "Write compound of given SMILES. -> CCOP(=S)(OCC)ON=C(C#N)c1ccccc1\n"}, {"from": "gpt", "value": " Phoxim\n"}]
[{"from": "human", "value": "Write water solubility expressed as a logarithm in mol/L of given SELFIES in 25 \u00b0C. -> [C][O][C][=Branch1][C][=O][N][C][=N][C][=C][C][=C][Branch1][Branch2][C][=C][Ring1][=Branch1][NH1][Ring1][=Branch2][C][=Branch1][C][=O][C][=C][C][=C][C][=C][Ring1][=Branch1]\n"}, {"from": "gpt", "value": " -3.88\n"}]
[{"from": "human", "value": "Given compound, write its water solubility in room temperature. -> 2-Methylanthracene\n"}, {"from": "gpt", "value": " 1.0964781961431852e-07 mol/L\n"}]
[{"from": "human", "value": "Write compound of given SELFIES. -> [O][=C][N][C][=Branch1][C][=O][N][C][=Branch1][C][=O][C][Ring1][Branch2][Branch1][C][C][C][C]\n"}, {"from": "gpt", "value": " 5-Methyl-5-ethylbarbituric acid\n"}]
[{"from": "human", "value": "What is compound of given SMILES? -> CCC#C\n"}, {"from": "gpt", "value": " 1-Butyne\n"}]
[{"from": "human", "value": "Given compound, write its water solubility expressed as a logarithm in mol/L in 25 \u00b0C. -> Acenapthylene\n"}, {"from": "gpt", "value": " -3.96\n"}]
[{"from": "human", "value": "Write compound of given SMILES. -> ClC4=C(Cl)C5(Cl)C3C1CC(C2OC12)C3C4(Cl)C5(Cl)Cl\n"}, {"from": "gpt", "value": " Dieldrin\n"}]
[{"from": "human", "value": "What is InChI of given compound? -> 2,3',4',5-PCB\n"}, {"from": "gpt", "value": " InChI=1S/C12H6Cl4/c13-8-2-4-10(14)9(6-8)7-1-3-11(15)12(16)5-7/h1-6H\n"}]
[{"from": "human", "value": "What is water solubility expressed as a logarithm in mol/L of given InChI in 25 \u00b0C? -> InChI=1S/C6H10/c1-3-5-6-4-2/h3-4H2,1-2H3\n"}, {"from": "gpt", "value": " -1.99\n"}]
[{"from": "human", "value": "Given compound, write its aqueous solubility in room temperature. -> 2-Methylbutane\n"}, {"from": "gpt", "value": " 0.0006606934480075957 mol/L\n"}]
[{"from": "human", "value": "Given compound, write its potential SMILES. -> ethofumesate\n"}, {"from": "gpt", "value": " CCOC2Oc1ccc(OS(C)(=O)=O)cc1C2(C)C\n"}]
[{"from": "human", "value": "Given SMILES, write its water solubility in 25 \u00b0C. -> CCOP(=S)(OCC)SCCSCC\n"}, {"from": "gpt", "value": " 5.888436553555884e-05 mol/L\n"}]
[{"from": "human", "value": "Write compound of given SELFIES. -> [N][Branch1][=Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=C][C][=C][C][=C][Ring1][=Branch1]\n"}, {"from": "gpt", "value": " Diphenylamine\n"}]
[{"from": "human", "value": "Given SMILES, write its compound. -> Cc1cccc(C)c1NC(=O)c2cc(c(Cl)cc2O)S(N)(=O)=O\n"}, {"from": "gpt", "value": " Xipamide\n"}]
[{"from": "human", "value": "What is water solubility of given compound in 25 \u00b0C? -> Acenapthene\n"}, {"from": "gpt", "value": " 2.344228815319923e-05 mol/L\n"}]
[{"from": "human", "value": "What will be SMILES of given compound? -> 1-Bromo-2-methylpropane\n"}, {"from": "gpt", "value": " CC(C)CBr\n"}]
[{"from": "human", "value": "What is aqueous solubility of given SMILES in room temperature? -> CCCC=C(CC)C=O\n"}, {"from": "gpt", "value": " 0.0034673685045253167 mol/L\n"}]
[{"from": "human", "value": "Write aqueous solubility of given InChI in 25 \u00b0C. -> InChI=1S/C6H14/c1-4-6(3)5-2/h6H,4-5H2,1-3H3\n"}, {"from": "gpt", "value": " 0.00020892961308540387 mol/L\n"}]
[{"from": "human", "value": "What is InChI of given compound? -> Phenylthiourea\n"}, {"from": "gpt", "value": " InChI=1S/C7H8N2S/c8-7(10)9-6-4-2-1-3-5-6/h1-5H,(H3,8,9,10)\n"}]
[{"from": "human", "value": "What will be SELFIES of given compound? -> Phenylmethanol\n"}, {"from": "gpt", "value": " [O][C][C][=C][C][=C][C][=C][Ring1][=Branch1]\n"}]
[{"from": "human", "value": "What is water solubility of given compound in 25 \u00b0C? -> 1,2,4-Trichlorobenzene\n"}, {"from": "gpt", "value": " 0.0002570395782768865 mol/L\n"}]
[{"from": "human", "value": "Write compound of given InChI. -> InChI=1S/C10H14O/c1-10(2,3)8-4-6-9(11)7-5-8/h4-7,11H,1-3H3\n"}, {"from": "gpt", "value": " p-t-Butylphenol\n"}]
[{"from": "human", "value": "What is compound of given SMILES? -> COP(=S)(OC)Oc1cc(Cl)c(Cl)cc1Cl\n"}, {"from": "gpt", "value": " Ronnel\n"}]
[{"from": "human", "value": "What is compound of given InChI? -> InChI=1S/C7H9N/c1-6-3-4-8-5-7(6)2/h3-5H,1-2H3\n"}, {"from": "gpt", "value": " 3,4-Dimethylpyridine\n"}]
[{"from": "human", "value": "What is aqueous solubility expressed as a logarithm in mol/L of given InChI in room temperature? -> InChI=1S/C8H10O/c1-7(9)8-5-3-2-4-6-8/h2-7,9H,1H3\n"}, {"from": "gpt", "value": " -0.92\n"}]
[{"from": "human", "value": "What is aqueous solubility expressed as a logarithm in mol/L of given SMILES in room temperature? -> CCc1ccc(C)cc1\n"}, {"from": "gpt", "value": " -3.11\n"}]
[{"from": "human", "value": "What is compound of given InChI? -> InChI=1S/CHBrCl2/c2-1(3)4/h1H\n"}, {"from": "gpt", "value": " Bromodichloromethane\n"}]
[{"from": "human", "value": "Given compound, write its water solubility in room temperature. -> Pyridazine\n"}, {"from": "gpt", "value": " 12.589254117941675 mol/L\n"}]